C14H25NO — CID 103277769
2-(cyclopropylmethylamino)-2-(3,5-dimethylcyclohex-3-en-1-yl)ethanol (PubChem CID 103277769) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-2-(3,5-dimethylcyclohex-3-en-1-yl)ethanol.
| Compound Name | 2-(cyclopropylmethylamino)-2-(3,5-dimethylcyclohex-3-en-1-yl)ethanol |
|---|---|
| PubChem CID | 103277769 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 2-(cyclopropylmethylamino)-2-(3,5-dimethylcyclohex-3-en-1-yl)ethanol |
| SMILES | CC1=CC(C)CC(C(CO)NCC2CC2)C1 |
| InChI | InChI=1S/C14H25NO/c1-10-5-11(2)7-13(6-10)14(9-16)15-8-12-3-4-12/h5,10,12-16H,3-4,6-9H2,1-2H3 |
| InChIKey | NIEJQKMSMYTOIN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|