C12H21NO — CID 103277917
2-(3,5-dimethylcyclohex-3-en-1-yl)oxolan-3-amine (PubChem CID 103277917) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohex-3-en-1-yl)oxolan-3-amine.
| Compound Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 103277917 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)oxolan-3-amine |
| SMILES | CC1=CC(C)CC(C2OCCC2N)C1 |
| InChI | InChI=1S/C12H21NO/c1-8-5-9(2)7-10(6-8)12-11(13)3-4-14-12/h5,8,10-12H,3-4,6-7,13H2,1-2H3 |
| InChIKey | GWTRLIZBPAZXQN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|