About N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine
N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine (PubChem CID 103278885) has the molecular formula C15H20N4
and a molecular weight of 256.35 g/mol. Its IUPAC name is N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine |
| PubChem CID | 103278885 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine |
| SMILES | CCc1ccc(-c2nc(NCCN)ncc2C)cc1 |
| InChI | InChI=1S/C15H20N4/c1-3-12-4-6-13(7-5-12)14-11(2)10-18-15(19-14)17-9-8-16/h4-7,10H,3,8-9,16H2,1-2H3,(H,17,18,19) |
| InChIKey | WSPXBEGSOGCNGW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine?
The IUPAC name of N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine (CID 103278885) is N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine.
What is the SMILES notation for N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine?
The canonical SMILES for N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine is CCc1ccc(-c2nc(NCCN)ncc2C)cc1.
What is the InChIKey of N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine?
The InChIKey is WSPXBEGSOGCNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4/c1-3-12-4-6-13(7-5-12)14-11(2)10-18-15(19-14)17-9-8-16/h4-7,10H,3,8-9,16H2,1-2H3,(H,17,18,19).
What are the key properties of N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine?
N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine has a molecular weight of 256.35 g/mol, XLogP of 2.39, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(4-ethylphenyl)-5-methylpyrimidin-2-yl]ethane-1,2-diamine is sourced from PubChem (CID 103278885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).