C24H26N2OS — CID 1032803
(11S)-N-[4-[2-(dimethylamino)ethoxy]phenyl]-6,11-dihydrobenzo[c][1]benzothiepin-11-amine (PubChem CID 1032803) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is (11S)-N-[4-[2-(dimethylamino)ethoxy]phenyl]-6,11-dihydrobenzo[c][1]benzothiepin-11-amine.
| Compound Name | (11S)-N-[4-[2-(dimethylamino)ethoxy]phenyl]-6,11-dihydrobenzo[c][1]benzothiepin-11-amine |
|---|---|
| PubChem CID | 1032803 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (11S)-N-[4-[2-(dimethylamino)ethoxy]phenyl]-6,11-dihydrobenzo[c][1]benzothiepin-11-amine |
| SMILES | CN(C)CCOc1ccc(N[C@H]2c3ccccc3CSc3ccccc32)cc1 |
| InChI | InChI=1S/C24H26N2OS/c1-26(2)15-16-27-20-13-11-19(12-14-20)25-24-21-8-4-3-7-18(21)17-28-23-10-6-5-9-22(23)24/h3-14,24-25H,15-17H2,1-2H3/t24-/m0/s1 |
| InChIKey | DUBXCYUMCWFEIA-DEOSSOPVSA-N |
| XLogP | 5.43 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|