C19H23N3O3S — CID 89005886
2-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide (PubChem CID 89005886) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide.
| Compound Name | 2-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 89005886 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[2-[4-[2-(dimethylamino)ethoxy]phenyl]-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide |
| SMILES | CN(C)CCOc1ccc(N2Sc3ccccc3C2CC(=O)NO)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-21(2)11-12-25-15-9-7-14(8-10-15)22-17(13-19(23)20-24)16-5-3-4-6-18(16)26-22/h3-10,17,24H,11-13H2,1-2H3,(H,20,23) |
| InChIKey | AILGZUREVQHHLW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|