C40H64O18 — CID 10328139
[(2R,3S,4S,5R,6S)-6-[[(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(2-methylpropanoyloxy)oxan-2-yl]methoxy]-3,4,5-tris(2-methylpropanoyloxy)oxan-2-yl]methyl 2-methylpropanoate (PubChem CID 10328139) has the molecular formula C40H64O18 and a molecular weight of 832.93 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[[(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(2-methylpropanoyloxy)oxan-2-yl]methoxy]-3,4,5-tris(2-methylpropanoyloxy)oxan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[[(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(2-methylpropanoyloxy)oxan-2-yl]methoxy]-3,4,5-tris(2-methylpropanoyloxy)oxan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 10328139 |
| Molecular Formula | C40H64O18 |
| Molecular Weight | 832.93 g/mol |
| Exact Mass | 832.41 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[(2R,3R,4S,5R,6S)-6-hydroxy-3,4,5-tris(2-methylpropanoyloxy)oxan-2-yl]methoxy]-3,4,5-tris(2-methylpropanoyloxy)oxan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O)[C@H](OC(=O)C(C)C)[C@@H](OC(=O)C(C)C)[C@@H]2OC(=O)C(C)C)[C@H](OC(=O)C(C)C)[C@@H](OC(=O)C(C)C)[C@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C40H64O18/c1-17(2)32(41)49-15-25-27(54-34(43)19(5)6)29(56-36(45)21(9)10)31(58-38(47)23(13)14)40(52-25)50-16-24-26(53-33(42)18(3)4)28(55-35(44)20(7)8)30(39(48)51-24)57-37(46)22(11)12/h17-31,39-40,48H,15-16H2,1-14H3/t24-,25-,26-,27+,28+,29+,30-,31-,39+,40+/m1/s1 |
| InChIKey | XDOFSSGFSXLUIX-QFDCGPSDSA-N |
| XLogP | 3.05 |
| TPSA | 232.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|