C14H19N3S — CID 103281456
4-thiophen-3-yl-2,3,4,5a,6,7,8,9,9a,10-decahydropyrimido[1,2-a]benzimidazole (PubChem CID 103281456) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 4-thiophen-3-yl-2,3,4,5a,6,7,8,9,9a,10-decahydropyrimido[1,2-a]benzimidazole.
| Compound Name | 4-thiophen-3-yl-2,3,4,5a,6,7,8,9,9a,10-decahydropyrimido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 103281456 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-thiophen-3-yl-2,3,4,5a,6,7,8,9,9a,10-decahydropyrimido[1,2-a]benzimidazole |
| SMILES | c1cc(C2CCN=C3NC4CCCCC4N32)cs1 |
| InChI | InChI=1S/C14H19N3S/c1-2-4-13-11(3-1)16-14-15-7-5-12(17(13)14)10-6-8-18-9-10/h6,8-9,11-13H,1-5,7H2,(H,15,16) |
| InChIKey | ZJWXNKQXSMBLBA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |