C11H17ClN2S — CID 130747704
1-(azetidin-3-yl)-2-thiophen-3-ylpyrrolidine;hydrochloride (PubChem CID 130747704) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-2-thiophen-3-ylpyrrolidine;hydrochloride.
| Compound Name | 1-(azetidin-3-yl)-2-thiophen-3-ylpyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 130747704 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-(azetidin-3-yl)-2-thiophen-3-ylpyrrolidine;hydrochloride |
| SMILES | Cl.c1cc(C2CCCN2C2CNC2)cs1 |
| InChI | InChI=1S/C11H16N2S.ClH/c1-2-11(9-3-5-14-8-9)13(4-1)10-6-12-7-10;/h3,5,8,10-12H,1-2,4,6-7H2;1H |
| InChIKey | VIEKYFGWIJBXND-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |