C14H18N2O2S — CID 94171138
(5S)-5-[(2S)-2-thiophen-3-ylpyrrolidine-1-carbonyl]piperidin-2-one (PubChem CID 94171138) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is (5S)-5-[(2S)-2-thiophen-3-ylpyrrolidine-1-carbonyl]piperidin-2-one.
| Compound Name | (5S)-5-[(2S)-2-thiophen-3-ylpyrrolidine-1-carbonyl]piperidin-2-one |
|---|---|
| PubChem CID | 94171138 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (5S)-5-[(2S)-2-thiophen-3-ylpyrrolidine-1-carbonyl]piperidin-2-one |
| SMILES | O=C1CC[C@H](C(=O)N2CCC[C@H]2c2ccsc2)CN1 |
| InChI | InChI=1S/C14H18N2O2S/c17-13-4-3-10(8-15-13)14(18)16-6-1-2-12(16)11-5-7-19-9-11/h5,7,9-10,12H,1-4,6,8H2,(H,15,17)/t10-,12-/m0/s1 |
| InChIKey | ISOHBILGJQSDNH-JQWIXIFHSA-N |
| XLogP | 1.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |