C9H15ClN2OS — CID 103284550
2-(chloromethyl)-5-(2-methylpentoxy)-1,3,4-thiadiazole (PubChem CID 103284550) has the molecular formula C9H15ClN2OS and a molecular weight of 234.75 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(2-methylpentoxy)-1,3,4-thiadiazole.
| Compound Name | 2-(chloromethyl)-5-(2-methylpentoxy)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 103284550 |
| Molecular Formula | C9H15ClN2OS |
| Molecular Weight | 234.75 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-(chloromethyl)-5-(2-methylpentoxy)-1,3,4-thiadiazole |
| SMILES | CCCC(C)COc1nnc(CCl)s1 |
| InChI | InChI=1S/C9H15ClN2OS/c1-3-4-7(2)6-13-9-12-11-8(5-10)14-9/h7H,3-6H2,1-2H3 |
| InChIKey | DSWNKFLRBLCSNJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.75 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|