C12H19ClN2O — CID 103283695
3-chloro-4,5-dimethyl-6-(2-methylpentoxy)pyridazine (PubChem CID 103283695) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 3-chloro-4,5-dimethyl-6-(2-methylpentoxy)pyridazine.
| Compound Name | 3-chloro-4,5-dimethyl-6-(2-methylpentoxy)pyridazine |
|---|---|
| PubChem CID | 103283695 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-chloro-4,5-dimethyl-6-(2-methylpentoxy)pyridazine |
| SMILES | CCCC(C)COc1nnc(Cl)c(C)c1C |
| InChI | InChI=1S/C12H19ClN2O/c1-5-6-8(2)7-16-12-10(4)9(3)11(13)14-15-12/h8H,5-7H2,1-4H3 |
| InChIKey | AZGJWQDGKSGQCB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |