About 2-methylpentyl 6-amino-1H-indole-3-carboxylate
2-methylpentyl 6-amino-1H-indole-3-carboxylate (PubChem CID 103284577) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-methylpentyl 6-amino-1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | 2-methylpentyl 6-amino-1H-indole-3-carboxylate |
| PubChem CID | 103284577 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-methylpentyl 6-amino-1H-indole-3-carboxylate |
| SMILES | CCCC(C)COC(=O)c1c[nH]c2cc(N)ccc12 |
| InChI | InChI=1S/C15H20N2O2/c1-3-4-10(2)9-19-15(18)13-8-17-14-7-11(16)5-6-12(13)14/h5-8,10,17H,3-4,9,16H2,1-2H3 |
| InChIKey | NBHBHMICFKYQOQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentyl 6-amino-1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl 6-amino-1H-indole-3-carboxylate?
The IUPAC name of 2-methylpentyl 6-amino-1H-indole-3-carboxylate (CID 103284577) is 2-methylpentyl 6-amino-1H-indole-3-carboxylate.
What is the SMILES notation for 2-methylpentyl 6-amino-1H-indole-3-carboxylate?
The canonical SMILES for 2-methylpentyl 6-amino-1H-indole-3-carboxylate is CCCC(C)COC(=O)c1c[nH]c2cc(N)ccc12.
What is the InChIKey of 2-methylpentyl 6-amino-1H-indole-3-carboxylate?
The InChIKey is NBHBHMICFKYQOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-3-4-10(2)9-19-15(18)13-8-17-14-7-11(16)5-6-12(13)14/h5-8,10,17H,3-4,9,16H2,1-2H3.
What are the key properties of 2-methylpentyl 6-amino-1H-indole-3-carboxylate?
2-methylpentyl 6-amino-1H-indole-3-carboxylate has a molecular weight of 260.34 g/mol, XLogP of 3.34, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl 6-amino-1H-indole-3-carboxylate is sourced from PubChem (CID 103284577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).