C13H23N3O — CID 103285313
N,6-dimethyl-2-(2-methylpentoxymethyl)pyrimidin-4-amine (PubChem CID 103285313) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is N,6-dimethyl-2-(2-methylpentoxymethyl)pyrimidin-4-amine.
| Compound Name | N,6-dimethyl-2-(2-methylpentoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103285313 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N,6-dimethyl-2-(2-methylpentoxymethyl)pyrimidin-4-amine |
| SMILES | CCCC(C)COCc1nc(C)cc(NC)n1 |
| InChI | InChI=1S/C13H23N3O/c1-5-6-10(2)8-17-9-13-15-11(3)7-12(14-4)16-13/h7,10H,5-6,8-9H2,1-4H3,(H,14,15,16) |
| InChIKey | NWCHWUGOZJAGDF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |