C13H21N3O3S — CID 103287799
5-amino-N-methyl-2-(2-pyrrolidin-1-ylethoxy)benzenesulfonamide (PubChem CID 103287799) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 5-amino-N-methyl-2-(2-pyrrolidin-1-ylethoxy)benzenesulfonamide.
| Compound Name | 5-amino-N-methyl-2-(2-pyrrolidin-1-ylethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 103287799 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 5-amino-N-methyl-2-(2-pyrrolidin-1-ylethoxy)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1OCCN1CCCC1 |
| InChI | InChI=1S/C13H21N3O3S/c1-15-20(17,18)13-10-11(14)4-5-12(13)19-9-8-16-6-2-3-7-16/h4-5,10,15H,2-3,6-9,14H2,1H3 |
| InChIKey | OWXCCGBXHIHZFG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|