About 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide
5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide (PubChem CID 103287840) has the molecular formula C13H18N4O3S
and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide.
Molecular Properties
| Compound Name | 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide |
| PubChem CID | 103287840 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(N)ccc1Oc1c(C)nn(C)c1C |
| InChI | InChI=1S/C13H18N4O3S/c1-8-13(9(2)17(4)16-8)20-11-6-5-10(14)7-12(11)21(18,19)15-3/h5-7,15H,14H2,1-4H3 |
| InChIKey | QAIXBJWJEFDMMW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide?
The IUPAC name of 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide (CID 103287840) is 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide.
What is the SMILES notation for 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide?
The canonical SMILES for 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide is CNS(=O)(=O)c1cc(N)ccc1Oc1c(C)nn(C)c1C.
What is the InChIKey of 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide?
The InChIKey is QAIXBJWJEFDMMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3S/c1-8-13(9(2)17(4)16-8)20-11-6-5-10(14)7-12(11)21(18,19)15-3/h5-7,15H,14H2,1-4H3.
What are the key properties of 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide?
5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide has a molecular weight of 310.38 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-methyl-2-(1,3,5-trimethylpyrazol-4-yl)oxybenzenesulfonamide is sourced from PubChem (CID 103287840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).