C14H20BrClS — CID 103288088
1-[[2-(bromomethyl)-3,3-dimethylbutyl]sulfanylmethyl]-2-chlorobenzene (PubChem CID 103288088) has the molecular formula C14H20BrClS and a molecular weight of 335.74 g/mol. Its IUPAC name is 1-[[2-(bromomethyl)-3,3-dimethylbutyl]sulfanylmethyl]-2-chlorobenzene.
| Compound Name | 1-[[2-(bromomethyl)-3,3-dimethylbutyl]sulfanylmethyl]-2-chlorobenzene |
|---|---|
| PubChem CID | 103288088 |
| Molecular Formula | C14H20BrClS |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 1-[[2-(bromomethyl)-3,3-dimethylbutyl]sulfanylmethyl]-2-chlorobenzene |
| SMILES | CC(C)(C)C(CBr)CSCc1ccccc1Cl |
| InChI | InChI=1S/C14H20BrClS/c1-14(2,3)12(8-15)10-17-9-11-6-4-5-7-13(11)16/h4-7,12H,8-10H2,1-3H3 |
| InChIKey | JDKDVLTUSMXGBY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|