C10H14ClNOS — CID 103288623
1-amino-3-[(2-chlorophenyl)methylsulfanyl]propan-2-ol (PubChem CID 103288623) has the molecular formula C10H14ClNOS and a molecular weight of 231.75 g/mol. Its IUPAC name is 1-amino-3-[(2-chlorophenyl)methylsulfanyl]propan-2-ol.
| Compound Name | 1-amino-3-[(2-chlorophenyl)methylsulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 103288623 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 1-amino-3-[(2-chlorophenyl)methylsulfanyl]propan-2-ol |
| SMILES | NCC(O)CSCc1ccccc1Cl |
| InChI | InChI=1S/C10H14ClNOS/c11-10-4-2-1-3-8(10)6-14-7-9(13)5-12/h1-4,9,13H,5-7,12H2 |
| InChIKey | FDJMQNKAMPYXQR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |