C11H12ClF3N2OS — CID 103371375
2-[(2-chlorophenyl)methylsulfanylmethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103371375) has the molecular formula C11H12ClF3N2OS and a molecular weight of 312.74 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanylmethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanylmethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103371375 |
| Molecular Formula | C11H12ClF3N2OS |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanylmethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | N/C(=N/O)C(CSCc1ccccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C11H12ClF3N2OS/c12-9-4-2-1-3-7(9)5-19-6-8(10(16)17-18)11(13,14)15/h1-4,8,18H,5-6H2,(H2,16,17) |
| InChIKey | JKIPASZYQUNDBH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|