C10H9F5N2OS — CID 103371317
2-[(2,4-difluorophenyl)sulfanylmethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103371317) has the molecular formula C10H9F5N2OS and a molecular weight of 300.25 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)sulfanylmethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[(2,4-difluorophenyl)sulfanylmethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103371317 |
| Molecular Formula | C10H9F5N2OS |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-[(2,4-difluorophenyl)sulfanylmethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | N/C(=N/O)C(CSc1ccc(F)cc1F)C(F)(F)F |
| InChI | InChI=1S/C10H9F5N2OS/c11-5-1-2-8(7(12)3-5)19-4-6(9(16)17-18)10(13,14)15/h1-3,6,18H,4H2,(H2,16,17) |
| InChIKey | MRFMBMMMMCHAPG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|