C11H14F2N2OS — CID 109374829
5-(2,4-difluorophenyl)sulfanyl-N'-hydroxypentanimidamide (PubChem CID 109374829) has the molecular formula C11H14F2N2OS and a molecular weight of 260.31 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)sulfanyl-N'-hydroxypentanimidamide.
| Compound Name | 5-(2,4-difluorophenyl)sulfanyl-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 109374829 |
| Molecular Formula | C11H14F2N2OS |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-(2,4-difluorophenyl)sulfanyl-N'-hydroxypentanimidamide |
| SMILES | N/C(CCCCSc1ccc(F)cc1F)=N/O |
| InChI | InChI=1S/C11H14F2N2OS/c12-8-4-5-10(9(13)7-8)17-6-2-1-3-11(14)15-16/h4-5,7,16H,1-3,6H2,(H2,14,15) |
| InChIKey | YXFUWZFACYOCPR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|