C14H22N2OS — CID 54966132
N'-hydroxy-5-(4-propan-2-ylphenyl)sulfanylpentanimidamide (PubChem CID 54966132) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is N'-hydroxy-5-(4-propan-2-ylphenyl)sulfanylpentanimidamide.
| Compound Name | N'-hydroxy-5-(4-propan-2-ylphenyl)sulfanylpentanimidamide |
|---|---|
| PubChem CID | 54966132 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N'-hydroxy-5-(4-propan-2-ylphenyl)sulfanylpentanimidamide |
| SMILES | CC(C)c1ccc(SCCCCC(N)=NO)cc1 |
| InChI | InChI=1S/C14H22N2OS/c1-11(2)12-6-8-13(9-7-12)18-10-4-3-5-14(15)16-17/h6-9,11,17H,3-5,10H2,1-2H3,(H2,15,16) |
| InChIKey | NARVBYADDMBQCH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|