C17H29NS — CID 106713289
2,2-dimethyl-6-(4-propan-2-ylphenyl)sulfanylhexan-1-amine (PubChem CID 106713289) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4-propan-2-ylphenyl)sulfanylhexan-1-amine.
| Compound Name | 2,2-dimethyl-6-(4-propan-2-ylphenyl)sulfanylhexan-1-amine |
|---|---|
| PubChem CID | 106713289 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2,2-dimethyl-6-(4-propan-2-ylphenyl)sulfanylhexan-1-amine |
| SMILES | CC(C)c1ccc(SCCCCC(C)(C)CN)cc1 |
| InChI | InChI=1S/C17H29NS/c1-14(2)15-7-9-16(10-8-15)19-12-6-5-11-17(3,4)13-18/h7-10,14H,5-6,11-13,18H2,1-4H3 |
| InChIKey | MHDWVRVEMPBQTA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|