C12H15ClF2S — CID 63500217
1-(6-chlorohexylsulfanyl)-2,4-difluorobenzene (PubChem CID 63500217) has the molecular formula C12H15ClF2S and a molecular weight of 264.77 g/mol. Its IUPAC name is 1-(6-chlorohexylsulfanyl)-2,4-difluorobenzene.
| Compound Name | 1-(6-chlorohexylsulfanyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 63500217 |
| Molecular Formula | C12H15ClF2S |
| Molecular Weight | 264.77 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1-(6-chlorohexylsulfanyl)-2,4-difluorobenzene |
| SMILES | Fc1ccc(SCCCCCCCl)c(F)c1 |
| InChI | InChI=1S/C12H15ClF2S/c13-7-3-1-2-4-8-16-12-6-5-10(14)9-11(12)15/h5-6,9H,1-4,7-8H2 |
| InChIKey | ZEASBCLSDYGMDS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.77 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|