C11H15ClN2OS — CID 103288540
2-[(2-chlorophenyl)methylsulfanyl]-N'-hydroxybutanimidamide (PubChem CID 103288540) has the molecular formula C11H15ClN2OS and a molecular weight of 258.77 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N'-hydroxybutanimidamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 103288540 |
| Molecular Formula | C11H15ClN2OS |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N'-hydroxybutanimidamide |
| SMILES | CCC(SCc1ccccc1Cl)/C(N)=N/O |
| InChI | InChI=1S/C11H15ClN2OS/c1-2-10(11(13)14-15)16-7-8-5-3-4-6-9(8)12/h3-6,10,15H,2,7H2,1H3,(H2,13,14) |
| InChIKey | ACKPYUZUKKKFOC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|