C14H22ClNS — CID 103291071
2-[(2-chlorophenyl)methylsulfanyl]-N-ethylpentan-3-amine (PubChem CID 103291071) has the molecular formula C14H22ClNS and a molecular weight of 271.86 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-N-ethylpentan-3-amine.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-ethylpentan-3-amine |
|---|---|
| PubChem CID | 103291071 |
| Molecular Formula | C14H22ClNS |
| Molecular Weight | 271.86 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-N-ethylpentan-3-amine |
| SMILES | CCNC(CC)C(C)SCc1ccccc1Cl |
| InChI | InChI=1S/C14H22ClNS/c1-4-14(16-5-2)11(3)17-10-12-8-6-7-9-13(12)15/h6-9,11,14,16H,4-5,10H2,1-3H3 |
| InChIKey | XIIRQTURYRAPOA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |