C15H14ClFN2OS — CID 103288550
2-[(2-chlorophenyl)methylsulfanylmethyl]-5-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 103288550) has the molecular formula C15H14ClFN2OS and a molecular weight of 324.81 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanylmethyl]-5-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanylmethyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 103288550 |
| Molecular Formula | C15H14ClFN2OS |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanylmethyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1cc(F)ccc1CSCc1ccccc1Cl |
| InChI | InChI=1S/C15H14ClFN2OS/c16-14-4-2-1-3-11(14)9-21-8-10-5-6-12(17)7-13(10)15(18)19-20/h1-7,20H,8-9H2,(H2,18,19) |
| InChIKey | APDPWLUNKVBVDA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|