C14H12ClF2N3O — CID 77028971
2-[(2-chloro-4-fluoroanilino)methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 77028971) has the molecular formula C14H12ClF2N3O and a molecular weight of 311.72 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluoroanilino)methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[(2-chloro-4-fluoroanilino)methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77028971 |
| Molecular Formula | C14H12ClF2N3O |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-[(2-chloro-4-fluoroanilino)methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cc(F)ccc1CNc1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H12ClF2N3O/c15-12-6-10(17)3-4-13(12)19-7-8-1-2-9(16)5-11(8)14(18)20-21/h1-6,19,21H,7H2,(H2,18,20) |
| InChIKey | YPHSHUHKNOKJSF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|