C11H16FN3O3 — CID 77065005
2-[(1,3-dihydroxypropan-2-ylamino)methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 77065005) has the molecular formula C11H16FN3O3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-[(1,3-dihydroxypropan-2-ylamino)methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[(1,3-dihydroxypropan-2-ylamino)methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77065005 |
| Molecular Formula | C11H16FN3O3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[(1,3-dihydroxypropan-2-ylamino)methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cc(F)ccc1CNC(CO)CO |
| InChI | InChI=1S/C11H16FN3O3/c12-8-2-1-7(4-14-9(5-16)6-17)10(3-8)11(13)15-18/h1-3,9,14,16-18H,4-6H2,(H2,13,15) |
| InChIKey | IEZKTLSKIVCUCP-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|