C13H15FN4OS — CID 77045189
5-fluoro-N'-hydroxy-2-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]benzenecarboximidamide (PubChem CID 77045189) has the molecular formula C13H15FN4OS and a molecular weight of 294.36 g/mol. Its IUPAC name is 5-fluoro-N'-hydroxy-2-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]benzenecarboximidamide.
| Compound Name | 5-fluoro-N'-hydroxy-2-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 77045189 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-fluoro-N'-hydroxy-2-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]benzenecarboximidamide |
| SMILES | CC(NCc1ccc(F)cc1C(N)=NO)c1nccs1 |
| InChI | InChI=1S/C13H15FN4OS/c1-8(13-16-4-5-20-13)17-7-9-2-3-10(14)6-11(9)12(15)18-19/h2-6,8,17,19H,7H2,1H3,(H2,15,18) |
| InChIKey | QKTVNGNMRMKHQQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|