C12H13FN2OS — CID 112606910
2-fluoro-6-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]phenol (PubChem CID 112606910) has the molecular formula C12H13FN2OS and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-fluoro-6-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]phenol.
| Compound Name | 2-fluoro-6-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 112606910 |
| Molecular Formula | C12H13FN2OS |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-fluoro-6-[[1-(1,3-thiazol-2-yl)ethylamino]methyl]phenol |
| SMILES | CC(NCc1cccc(F)c1O)c1nccs1 |
| InChI | InChI=1S/C12H13FN2OS/c1-8(12-14-5-6-17-12)15-7-9-3-2-4-10(13)11(9)16/h2-6,8,15-16H,7H2,1H3 |
| InChIKey | ZRKIMXYJAJOQEP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|