C12H11BrF4O — CID 103289387
3-[[1-(bromomethyl)cyclobutyl]methoxy]-1,2,4,5-tetrafluorobenzene (PubChem CID 103289387) has the molecular formula C12H11BrF4O and a molecular weight of 327.12 g/mol. Its IUPAC name is 3-[[1-(bromomethyl)cyclobutyl]methoxy]-1,2,4,5-tetrafluorobenzene.
| Compound Name | 3-[[1-(bromomethyl)cyclobutyl]methoxy]-1,2,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 103289387 |
| Molecular Formula | C12H11BrF4O |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 3-[[1-(bromomethyl)cyclobutyl]methoxy]-1,2,4,5-tetrafluorobenzene |
| SMILES | Fc1cc(F)c(F)c(OCC2(CBr)CCC2)c1F |
| InChI | InChI=1S/C12H11BrF4O/c13-5-12(2-1-3-12)6-18-11-9(16)7(14)4-8(15)10(11)17/h4H,1-3,5-6H2 |
| InChIKey | ABUHXDQSBKSFBL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|