C15H22ClNO2S — CID 103290116
N-[2-[(2-chlorophenyl)methylsulfonyl]-1-cyclopropylethyl]propan-1-amine (PubChem CID 103290116) has the molecular formula C15H22ClNO2S and a molecular weight of 315.87 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methylsulfonyl]-1-cyclopropylethyl]propan-1-amine.
| Compound Name | N-[2-[(2-chlorophenyl)methylsulfonyl]-1-cyclopropylethyl]propan-1-amine |
|---|---|
| PubChem CID | 103290116 |
| Molecular Formula | C15H22ClNO2S |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methylsulfonyl]-1-cyclopropylethyl]propan-1-amine |
| SMILES | CCCNC(CS(=O)(=O)Cc1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C15H22ClNO2S/c1-2-9-17-15(12-7-8-12)11-20(18,19)10-13-5-3-4-6-14(13)16/h3-6,12,15,17H,2,7-11H2,1H3 |
| InChIKey | IJVPBZOTJCBBNJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |