C15H13ClN4O — CID 103292810
N-[(2-chloro-6-methoxyphenyl)methyl]pyrido[2,3-b]pyrazin-6-amine (PubChem CID 103292810) has the molecular formula C15H13ClN4O and a molecular weight of 300.75 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyphenyl)methyl]pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-[(2-chloro-6-methoxyphenyl)methyl]pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 103292810 |
| Molecular Formula | C15H13ClN4O |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-[(2-chloro-6-methoxyphenyl)methyl]pyrido[2,3-b]pyrazin-6-amine |
| SMILES | COc1cccc(Cl)c1CNc1ccc2nccnc2n1 |
| InChI | InChI=1S/C15H13ClN4O/c1-21-13-4-2-3-11(16)10(13)9-19-14-6-5-12-15(20-14)18-8-7-17-12/h2-8H,9H2,1H3,(H,18,19,20) |
| InChIKey | FCEDAQPQVZMNOJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |