C16H16N4 — CID 79003296
N-[(2-ethylphenyl)methyl]pyrido[2,3-b]pyrazin-6-amine (PubChem CID 79003296) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[(2-ethylphenyl)methyl]pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-[(2-ethylphenyl)methyl]pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 79003296 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-[(2-ethylphenyl)methyl]pyrido[2,3-b]pyrazin-6-amine |
| SMILES | CCc1ccccc1CNc1ccc2nccnc2n1 |
| InChI | InChI=1S/C16H16N4/c1-2-12-5-3-4-6-13(12)11-19-15-8-7-14-16(20-15)18-10-9-17-14/h3-10H,2,11H2,1H3,(H,18,19,20) |
| InChIKey | HLKVQVBIKDRWBZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |