C9H11N5 — CID 103294294
4,5-dimethyl-2-pyridazin-3-ylpyrazol-3-amine (PubChem CID 103294294) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 4,5-dimethyl-2-pyridazin-3-ylpyrazol-3-amine.
| Compound Name | 4,5-dimethyl-2-pyridazin-3-ylpyrazol-3-amine |
|---|---|
| PubChem CID | 103294294 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 4,5-dimethyl-2-pyridazin-3-ylpyrazol-3-amine |
| SMILES | Cc1nn(-c2cccnn2)c(N)c1C |
| InChI | InChI=1S/C9H11N5/c1-6-7(2)13-14(9(6)10)8-4-3-5-11-12-8/h3-5H,10H2,1-2H3 |
| InChIKey | ZUJDCWWREDZJCJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |