C14H19FN4 — CID 103294689
N-[(1-ethylpyrrolidin-2-yl)methyl]-6-fluoro-1H-benzimidazol-2-amine (PubChem CID 103294689) has the molecular formula C14H19FN4 and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-6-fluoro-1H-benzimidazol-2-amine.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-6-fluoro-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 103294689 |
| Molecular Formula | C14H19FN4 |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-6-fluoro-1H-benzimidazol-2-amine |
| SMILES | CCN1CCCC1CNc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C14H19FN4/c1-2-19-7-3-4-11(19)9-16-14-17-12-6-5-10(15)8-13(12)18-14/h5-6,8,11H,2-4,7,9H2,1H3,(H2,16,17,18) |
| InChIKey | HNXCJVJSBFTHQN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |