C17H23F2N7 — CID 142668736
2-N-(2,4-difluorophenyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 142668736) has the molecular formula C17H23F2N7 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-N-(2,4-difluorophenyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2,4-difluorophenyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 142668736 |
| Molecular Formula | C17H23F2N7 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-N-(2,4-difluorophenyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(NC)nc(Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C17H23F2N7/c1-3-26-8-4-5-12(26)10-21-16-23-15(20-2)24-17(25-16)22-14-7-6-11(18)9-13(14)19/h6-7,9,12H,3-5,8,10H2,1-2H3,(H3,20,21,22,23,24,25) |
| InChIKey | PUAUKQXVFIXCSA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |