C26H37F4N7O3 — CID 69206718
6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;2,2,2-trifluoroacetic acid (PubChem CID 69206718) has the molecular formula C26H37F4N7O3 and a molecular weight of 571.62 g/mol. Its IUPAC name is 6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69206718 |
| Molecular Formula | C26H37F4N7O3 |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | 6-N-(cyclohexylmethyl)-4-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CCCC1CNc1nc(NCC2CCCCC2)nc(Nc2ccc(OC)c(F)c2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H36FN7O.C2HF3O2/c1-3-32-13-7-10-19(32)16-27-23-29-22(26-15-17-8-5-4-6-9-17)30-24(31-23)28-18-11-12-21(33-2)20(25)14-18;3-2(4,5)1(6)7/h11-12,14,17,19H,3-10,13,15-16H2,1-2H3,(H3,26,27,28,29,30,31);(H,6,7) |
| InChIKey | JZCXMKFUARHRTK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |