C24H35FN8O — CID 21057819
2-N-(1-azabicyclo[2.2.2]octan-3-yl)-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 21057819) has the molecular formula C24H35FN8O and a molecular weight of 470.60 g/mol. Its IUPAC name is 2-N-(1-azabicyclo[2.2.2]octan-3-yl)-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(1-azabicyclo[2.2.2]octan-3-yl)-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 21057819 |
| Molecular Formula | C24H35FN8O |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 2-N-(1-azabicyclo[2.2.2]octan-3-yl)-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(Nc2ccc(OC)c(F)c2)nc(NC2CN3CCC2CC3)n1 |
| InChI | InChI=1S/C24H35FN8O/c1-3-33-10-4-5-18(33)14-26-22-29-23(27-17-6-7-21(34-2)19(25)13-17)31-24(30-22)28-20-15-32-11-8-16(20)9-12-32/h6-7,13,16,18,20H,3-5,8-12,14-15H2,1-2H3,(H3,26,27,28,29,30,31) |
| InChIKey | JQZCSUNDZNMWTN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |