C24H34FN7O — CID 11190283
2-N-cyclohept-2-en-1-yl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 11190283) has the molecular formula C24H34FN7O and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-N-cyclohept-2-en-1-yl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-cyclohept-2-en-1-yl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11190283 |
| Molecular Formula | C24H34FN7O |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 2-N-cyclohept-2-en-1-yl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(Nc2ccc(OC)c(F)c2)nc(NC2C=CCCCC2)n1 |
| InChI | InChI=1S/C24H34FN7O/c1-3-32-14-8-11-19(32)16-26-22-29-23(27-17-9-6-4-5-7-10-17)31-24(30-22)28-18-12-13-21(33-2)20(25)15-18/h6,9,12-13,15,17,19H,3-5,7-8,10-11,14,16H2,1-2H3,(H3,26,27,28,29,30,31) |
| InChIKey | ZMOLAHDXJZPOJT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|