C28H42FN7O5 — CID 69207171
butanedioic acid;2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 69207171) has the molecular formula C28H42FN7O5 and a molecular weight of 575.69 g/mol. Its IUPAC name is butanedioic acid;2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | butanedioic acid;2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 69207171 |
| Molecular Formula | C28H42FN7O5 |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | butanedioic acid;2-N-cycloheptyl-6-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(Nc2ccc(OC)c(F)c2)nc(NC2CCCCCC2)n1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C24H36FN7O.C4H6O4/c1-3-32-14-8-11-19(32)16-26-22-29-23(27-17-9-6-4-5-7-10-17)31-24(30-22)28-18-12-13-21(33-2)20(25)15-18;5-3(6)1-2-4(7)8/h12-13,15,17,19H,3-11,14,16H2,1-2H3,(H3,26,27,28,29,30,31);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | HFMYPIGJSNIOKJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 161.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |