C31H50FN7O5 — CID 11410999
6-N-(cyclohexylmethyl)-2-N-(3-fluoro-4-methoxyphenyl)-4-N-[[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]pyrrolidin-2-yl]methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 11410999) has the molecular formula C31H50FN7O5 and a molecular weight of 619.78 g/mol. Its IUPAC name is 6-N-(cyclohexylmethyl)-2-N-(3-fluoro-4-methoxyphenyl)-4-N-[[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]pyrrolidin-2-yl]methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(cyclohexylmethyl)-2-N-(3-fluoro-4-methoxyphenyl)-4-N-[[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]pyrrolidin-2-yl]methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11410999 |
| Molecular Formula | C31H50FN7O5 |
| Molecular Weight | 619.78 g/mol |
| Exact Mass | 619.39 |
| IUPAC Name | 6-N-(cyclohexylmethyl)-2-N-(3-fluoro-4-methoxyphenyl)-4-N-[[1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]pyrrolidin-2-yl]methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COCCOCCOCCOCCN1CCCC1CNc1nc(NCC2CCCCC2)nc(Nc2ccc(OC)c(F)c2)n1 |
| InChI | InChI=1S/C31H50FN7O5/c1-40-15-16-43-19-20-44-18-17-42-14-13-39-12-6-9-26(39)23-34-30-36-29(33-22-24-7-4-3-5-8-24)37-31(38-30)35-25-10-11-28(41-2)27(32)21-25/h10-11,21,24,26H,3-9,12-20,22-23H2,1-2H3,(H3,33,34,35,36,37,38) |
| InChIKey | WYNUNJANMMCQMT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.78 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|