About 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine
5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine (PubChem CID 170925575) has the molecular formula C19H24F2N4
and a molecular weight of 346.43 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine |
| PubChem CID | 170925575 |
| Molecular Formula | C19H24F2N4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine |
| SMILES | CCN1CCCCC1CNc1ncc(-c2ccc(F)cc2F)c(C)n1 |
| InChI | InChI=1S/C19H24F2N4/c1-3-25-9-5-4-6-15(25)11-22-19-23-12-17(13(2)24-19)16-8-7-14(20)10-18(16)21/h7-8,10,12,15H,3-6,9,11H2,1-2H3,(H,22,23,24) |
| InChIKey | VYBOKRKUCSDVCG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine?
The IUPAC name of 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine (CID 170925575) is 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine.
What is the SMILES notation for 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine?
The canonical SMILES for 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine is CCN1CCCCC1CNc1ncc(-c2ccc(F)cc2F)c(C)n1.
What is the InChIKey of 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine?
The InChIKey is VYBOKRKUCSDVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2N4/c1-3-25-9-5-4-6-15(25)11-22-19-23-12-17(13(2)24-19)16-8-7-14(20)10-18(16)21/h7-8,10,12,15H,3-6,9,11H2,1-2H3,(H,22,23,24).
What are the key properties of 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine?
5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine has a molecular weight of 346.43 g/mol, XLogP of 4.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-difluorophenyl)-N-[(1-ethylpiperidin-2-yl)methyl]-4-methylpyrimidin-2-amine is sourced from PubChem (CID 170925575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).