C11H19FN6 — CID 80944062
N-[(1-ethylpyrrolidin-2-yl)methyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine (PubChem CID 80944062) has the molecular formula C11H19FN6 and a molecular weight of 254.31 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80944062 |
| Molecular Formula | C11H19FN6 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine |
| SMILES | CCN1CCCC1CNc1nc(NN)ncc1F |
| InChI | InChI=1S/C11H19FN6/c1-2-18-5-3-4-8(18)6-14-10-9(12)7-15-11(16-10)17-13/h7-8H,2-6,13H2,1H3,(H2,14,15,16,17) |
| InChIKey | PVCZMJJOJLFXHI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|