C16H15F2N3 — CID 103295041
6-fluoro-N-[1-(3-fluoro-4-methylphenyl)ethyl]-1H-benzimidazol-2-amine (PubChem CID 103295041) has the molecular formula C16H15F2N3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 6-fluoro-N-[1-(3-fluoro-4-methylphenyl)ethyl]-1H-benzimidazol-2-amine.
| Compound Name | 6-fluoro-N-[1-(3-fluoro-4-methylphenyl)ethyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 103295041 |
| Molecular Formula | C16H15F2N3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 6-fluoro-N-[1-(3-fluoro-4-methylphenyl)ethyl]-1H-benzimidazol-2-amine |
| SMILES | Cc1ccc(C(C)Nc2nc3ccc(F)cc3[nH]2)cc1F |
| InChI | InChI=1S/C16H15F2N3/c1-9-3-4-11(7-13(9)18)10(2)19-16-20-14-6-5-12(17)8-15(14)21-16/h3-8,10H,1-2H3,(H2,19,20,21) |
| InChIKey | WTLJKSNCBITYQA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |