C6H13NO2S — CID 10329617
2-hydroxy-N-methyl-4-methylsulfanylbutanamide (PubChem CID 10329617) has the molecular formula C6H13NO2S and a molecular weight of 163.24 g/mol. Its IUPAC name is 2-hydroxy-N-methyl-4-methylsulfanylbutanamide.
| Compound Name | 2-hydroxy-N-methyl-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 10329617 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-hydroxy-N-methyl-4-methylsulfanylbutanamide |
| SMILES | CNC(=O)C(O)CCSC |
| InChI | InChI=1S/C6H13NO2S/c1-7-6(9)5(8)3-4-10-2/h5,8H,3-4H2,1-2H3,(H,7,9) |
| InChIKey | RTZNEWYJXRCWJR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |