C7H15NO2S — CID 10241354
2-hydroxy-N,N-dimethyl-4-methylsulfanylbutanamide (PubChem CID 10241354) has the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-4-methylsulfanylbutanamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 10241354 |
| Molecular Formula | C7H15NO2S |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-4-methylsulfanylbutanamide |
| SMILES | CSCCC(O)C(=O)N(C)C |
| InChI | InChI=1S/C7H15NO2S/c1-8(2)7(10)6(9)4-5-11-3/h6,9H,4-5H2,1-3H3 |
| InChIKey | HCMOVBCNKOGIES-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |