C11H13FN2O5S — CID 103298872
5-[[(3-fluoro-2-pyridinyl)sulfonylamino]methyl]oxolane-2-carboxylic acid (PubChem CID 103298872) has the molecular formula C11H13FN2O5S and a molecular weight of 304.30 g/mol. Its IUPAC name is 5-[[(3-fluoro-2-pyridinyl)sulfonylamino]methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[(3-fluoro-2-pyridinyl)sulfonylamino]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 103298872 |
| Molecular Formula | C11H13FN2O5S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 5-[[(3-fluoro-2-pyridinyl)sulfonylamino]methyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(CNS(=O)(=O)c2ncccc2F)O1 |
| InChI | InChI=1S/C11H13FN2O5S/c12-8-2-1-5-13-10(8)20(17,18)14-6-7-3-4-9(19-7)11(15)16/h1-2,5,7,9,14H,3-4,6H2,(H,15,16) |
| InChIKey | HFUSZOKVKFXBNY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |