C6H12O2S2 — CID 10329941
3-methoxy-1,1-bis(methylsulfanyl)propan-2-one (PubChem CID 10329941) has the molecular formula C6H12O2S2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 3-methoxy-1,1-bis(methylsulfanyl)propan-2-one.
| Compound Name | 3-methoxy-1,1-bis(methylsulfanyl)propan-2-one |
|---|---|
| PubChem CID | 10329941 |
| Molecular Formula | C6H12O2S2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 3-methoxy-1,1-bis(methylsulfanyl)propan-2-one |
| SMILES | COCC(=O)C(SC)SC |
| InChI | InChI=1S/C6H12O2S2/c1-8-4-5(7)6(9-2)10-3/h6H,4H2,1-3H3 |
| InChIKey | ZZURYQKSCFCUSO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|