C7H12O2S2 — CID 134985995
1-(1,3-dithiolan-2-yl)-1-methoxypropan-2-one (PubChem CID 134985995) has the molecular formula C7H12O2S2 and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-(1,3-dithiolan-2-yl)-1-methoxypropan-2-one.
| Compound Name | 1-(1,3-dithiolan-2-yl)-1-methoxypropan-2-one |
|---|---|
| PubChem CID | 134985995 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 1-(1,3-dithiolan-2-yl)-1-methoxypropan-2-one |
| SMILES | COC(C(C)=O)C1SCCS1 |
| InChI | InChI=1S/C7H12O2S2/c1-5(8)6(9-2)7-10-3-4-11-7/h6-7H,3-4H2,1-2H3 |
| InChIKey | XJEKQCNEMNNPGV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |